Products 284474-44-8
CAS 284474-44-8 appears in our catalog under these names: 1-Bromononane-1,1,2,2-d4, 98 atom % D, min 98% Chemical Purity, 1-Bromononane-d4-1. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
1-bromo-1,1,2,2-tetradeuteriononane (CAS 284474-44-8) is a chemical compound with the molecular formula C9H19Br and a molecular weight of 211.18 g/mol. IUPAC name: 1-bromo-1,1,2,2-tetradeuteriononane. InChIKey: AYMUQTNXKPEMLM-LZMSFWOYSA-N.
| Molecular formula | C9H19Br |
|---|---|
| Molecular weight | 211.18 g/mol |
| IUPAC name | 1-bromo-1,1,2,2-tetradeuteriononane |
| InChIKey | AYMUQTNXKPEMLM-LZMSFWOYSA-N |
| SMILES | [2H]C([2H])(CCCCCCC)C([2H])([2H])Br |
Computed by PubChem (NCBI)