Products 284474-72-2
CAS 284474-72-2 appears in our catalog under these names: (±)-2-Methyl-2,4-pentane-d12-diol, 99 atom % D, min 98% Chemical Purity, Hexylene glycol-d12. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 1 mg.
1,1,1,2,3,3,5,5,5-nonadeuterio-4-(trideuteriomethyl)pentane-2,4-diol (CAS 284474-72-2) is a chemical compound with the molecular formula C6H14O2 and a molecular weight of 130.25 g/mol. IUPAC name: 1,1,1,2,3,3,5,5,5-nonadeuterio-4-(trideuteriomethyl)pentane-2,4-diol. InChIKey: SVTBMSDMJJWYQN-WWKUACGSSA-N.
| Molecular formula | C6H14O2 |
|---|---|
| Molecular weight | 130.25 g/mol |
| IUPAC name | 1,1,1,2,3,3,5,5,5-nonadeuterio-4-(trideuteriomethyl)pentane-2,4-diol |
| InChIKey | SVTBMSDMJJWYQN-WWKUACGSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O)O |
Computed by PubChem (NCBI)