Products 284474-82-4
CAS 284474-82-4 appears in our catalog under these names: Tetramethyl-d12-ammonium Bromide, 99 atom % D, min 98% Chemical Purity, Tetramethyl-ammonium Bromide-d12. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
Tetrakis(trideuteriomethyl)azanium bromide (CAS 284474-82-4) is a chemical compound with the molecular formula C4H12BrN and a molecular weight of 166.12 g/mol. IUPAC name: tetrakis(trideuteriomethyl)azanium bromide. InChIKey: DDFYFBUWEBINLX-KXWZVCIVSA-M.
| Molecular formula | C4H12BrN |
|---|---|
| Molecular weight | 166.12 g/mol |
| IUPAC name | tetrakis(trideuteriomethyl)azanium bromide |
| InChIKey | DDFYFBUWEBINLX-KXWZVCIVSA-M |
| SMILES | [2H]C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H].[Br-] |
Computed by PubChem (NCBI)