Products 284487-64-5
CAS 284487-64-5 appears in our catalog under these names: tert-Butyl methyl ether-d12, 95%, tert-Butyl Methyl Ether-d12, tert-Butyl Methyl Ether-d12, 99 atom % D, min 98% Chemical Purity. Offered by: Combi-blocks, TRC, CDN. Available pack sizes: 100mg, 500mg, 10mg, 50mg, 5mg, 0,5g, 0,25g.
1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethoxy)-2-(trideuteriomethyl)propane (CAS 284487-64-5) is a chemical compound with the molecular formula C5H12O and a molecular weight of 100.22 g/mol. IUPAC name: 1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethoxy)-2-(trideuteriomethyl)propane. InChIKey: BZLVMXJERCGZMT-MGKWXGLJSA-N.
| Molecular formula | C5H12O |
|---|---|
| Molecular weight | 100.22 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethoxy)-2-(trideuteriomethyl)propane |
| InChIKey | BZLVMXJERCGZMT-MGKWXGLJSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)