Products 2845095-66-9
CAS 2845095-66-9 is the registry number for (2R,5R)-5-(4-Chlorobenzyl)-2-methylmorpholine Hydrochloride, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R,5R)-5-[(4-chlorophenyl)methyl]-2-methylmorpholine;hydrochloride (CAS 2845095-66-9) is a chemical compound with the molecular formula C12H17Cl2NO and a molecular weight of 262.17 g/mol. IUPAC name: (2R,5R)-5-[(4-chlorophenyl)methyl]-2-methylmorpholine;hydrochloride. InChIKey: ZTEASWYBEBQFRI-WYUVZMMLSA-N.
| Molecular formula | C12H17Cl2NO |
|---|---|
| Molecular weight | 262.17 g/mol |
| IUPAC name | (2R,5R)-5-[(4-chlorophenyl)methyl]-2-methylmorpholine;hydrochloride |
| InChIKey | ZTEASWYBEBQFRI-WYUVZMMLSA-N |
| SMILES | C[C@@H]1CN[C@@H](CO1)CC2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)