CAS 2845127-11-7 appears in our catalog under these names: 2-(4-(Trifluoromethoxy)phenoxy)thiazole-5-carboxylic acid, 95%, 95%, 2-(4-(Trifluoromethoxy)phenoxy)thiazole-5-carboxylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-[4-(trifluoromethoxy)phenoxy]-1,3-thiazole-5-carboxylic acid (CAS 2845127-11-7) is a chemical compound with the molecular formula C11H6F3NO4S and a molecular weight of 305.23 g/mol. IUPAC name: 2-[4-(trifluoromethoxy)phenoxy]-1,3-thiazole-5-carboxylic acid. InChIKey: DHMDYCFZADGMLZ-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO4S |
|---|---|
| Molecular weight | 305.23 g/mol |
| IUPAC name | 2-[4-(trifluoromethoxy)phenoxy]-1,3-thiazole-5-carboxylic acid |
| InChIKey | DHMDYCFZADGMLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=NC=C(S2)C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)