CAS 2845127-99-1 appears in our catalog under these names: 2-Amino-4,5-difluorophenol acetate, 95%, 95%, 2-Amino-4,5-difluorophenol acetate, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.
Acetic acid;2-amino-4,5-difluorophenol (CAS 2845127-99-1) is a chemical compound with the molecular formula C8H9F2NO3 and a molecular weight of 205.16 g/mol. IUPAC name: acetic acid;2-amino-4,5-difluorophenol. InChIKey: FDKOWHJSWLSWGP-UHFFFAOYSA-N.
| Molecular formula | C8H9F2NO3 |
|---|---|
| Molecular weight | 205.16 g/mol |
| IUPAC name | acetic acid;2-amino-4,5-difluorophenol |
| InChIKey | FDKOWHJSWLSWGP-UHFFFAOYSA-N |
| SMILES | CC(=O)O.C1=C(C(=CC(=C1F)F)O)N |
Computed by PubChem (NCBI)