Products 2845128-73-4
CAS 2845128-73-4 is the registry number for 2-Amino-6-bromo-N-phenylbenzamide, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-amino-6-bromo-N-phenylbenzamide (CAS 2845128-73-4) is a chemical compound with the molecular formula C13H11BrN2O and a molecular weight of 291.14 g/mol. IUPAC name: 2-amino-6-bromo-N-phenylbenzamide. InChIKey: MGDJTYHGFODYCH-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | 2-amino-6-bromo-N-phenylbenzamide |
| InChIKey | MGDJTYHGFODYCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=C(C=CC=C2Br)N |
Computed by PubChem (NCBI)