Products 2845132-43-4
CAS 2845132-43-4 is the registry number for Methyl (E)-3-(5-Bromo-1-Boc-3-indolyl)acrylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
Tert-butyl 5-bromo-3-[(Z)-3-methoxy-3-oxoprop-1-enyl]indole-1-carboxylate (CAS 2845132-43-4) is a chemical compound with the molecular formula C17H18BrNO4 and a molecular weight of 380.2 g/mol. IUPAC name: tert-butyl 5-bromo-3-[(Z)-3-methoxy-3-oxoprop-1-enyl]indole-1-carboxylate. InChIKey: NMBXSXYZZUQPIQ-YVMONPNESA-N.
| Molecular formula | C17H18BrNO4 |
|---|---|
| Molecular weight | 380.2 g/mol |
| IUPAC name | tert-butyl 5-bromo-3-[(Z)-3-methoxy-3-oxoprop-1-enyl]indole-1-carboxylate |
| InChIKey | NMBXSXYZZUQPIQ-YVMONPNESA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC(=C2)Br)/C=C\C(=O)OC |
Computed by PubChem (NCBI)