CAS 284664-85-3 appears in our catalog under these names: 3-(TRIMETHYLSILYL)-1-PROPANESULFONIC ACI, Sodium 3-(trimethylsilyl)propane-1-sulfonate-1,1,2,2,3,3-d6, 3-(Trimethylsilyl)-1-propane-1,1,2,2,3,3-d6-sulfonic Acid Sodium Salt, >95% (HPLC). Offered by: Sigma-Aldrich, Hubei YoungXin, TRC. Available pack sizes: 1G, 10mg, 25mg, 50mg, 100mg, 200mg.
Sodium 1,1,2,2,3,3-hexadeuterio-3-trimethylsilylpropane-1-sulfonate (CAS 284664-85-3) is a chemical compound with the molecular formula C6H15NaO3SSi and a molecular weight of 224.36 g/mol. IUPAC name: sodium 1,1,2,2,3,3-hexadeuterio-3-trimethylsilylpropane-1-sulfonate. InChIKey: HWEXKRHYVOGVDA-CHBZFOKHSA-M.
| Molecular formula | C6H15NaO3SSi |
|---|---|
| Molecular weight | 224.36 g/mol |
| IUPAC name | sodium 1,1,2,2,3,3-hexadeuterio-3-trimethylsilylpropane-1-sulfonate |
| InChIKey | HWEXKRHYVOGVDA-CHBZFOKHSA-M |
| SMILES | [2H]C([2H])(C([2H])([2H])[Si](C)(C)C)C([2H])([2H])S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)