CAS 284664-86-4 appears in our catalog under these names: Creatine-(methyl-d3) Monohydrate, Creatine-d3 H2O (methyl-d3), 99 atom % D, min 98% Chemical Purity, Creatine D3 hydrate, Creatine-d3 hydrate/ 92.96% (existing batch purity), CREATINE-D3 H2O (METHYL-D3), 98% ATOM% D. Offered by: TRC, CDN, GLPBio, TargetMol, Sigma-Aldrich. Available pack sizes: 100mg, 25mg, 50mg, 0,05g, 5mg, 1mg, 10mg, 1G.
2-[carbamimidoyl(trideuteriomethyl)amino]acetic acid;hydrate (CAS 284664-86-4) is a chemical compound with the molecular formula C4H11N3O3 and a molecular weight of 152.17 g/mol. IUPAC name: 2-[carbamimidoyl(trideuteriomethyl)amino]acetic acid;hydrate. InChIKey: MEJYXFHCRXAUIL-NIIDSAIPSA-N.
| Molecular formula | C4H11N3O3 |
|---|---|
| Molecular weight | 152.17 g/mol |
| IUPAC name | 2-[carbamimidoyl(trideuteriomethyl)amino]acetic acid;hydrate |
| InChIKey | MEJYXFHCRXAUIL-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])N(CC(=O)O)C(=N)N.O |
Computed by PubChem (NCBI)