Products 2847093-80-3
CAS 2847093-80-3 is the registry number for 2-(4-bromo-2-fluorophenoxy)-4-methylpyrimidine, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g.
2-(4-bromo-2-fluorophenoxy)-4-methylpyrimidine (CAS 2847093-80-3) is a chemical compound with the molecular formula C11H8BrFN2O and a molecular weight of 283.10 g/mol. IUPAC name: 2-(4-bromo-2-fluorophenoxy)-4-methylpyrimidine. InChIKey: SKHRMBJYYYVSCM-UHFFFAOYSA-N.
| Molecular formula | C11H8BrFN2O |
|---|---|
| Molecular weight | 283.10 g/mol |
| IUPAC name | 2-(4-bromo-2-fluorophenoxy)-4-methylpyrimidine |
| InChIKey | SKHRMBJYYYVSCM-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC=C1)OC2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)