CAS 2847094-27-1 is the registry number for (R)-2-((S)-tert-Butylsulfinyl)-1-methyl-2,6-diazaspiro[3.3]heptane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-tert-butylsulfinyl-3-methyl-2,6-diazaspiro[3.3]heptane (CAS 2847094-27-1) is a chemical compound with the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. IUPAC name: 2-tert-butylsulfinyl-3-methyl-2,6-diazaspiro[3.3]heptane. InChIKey: ATSUCJLIUNAALW-UHFFFAOYSA-N.
| Molecular formula | C10H20N2OS |
|---|---|
| Molecular weight | 216.35 g/mol |
| IUPAC name | 2-tert-butylsulfinyl-3-methyl-2,6-diazaspiro[3.3]heptane |
| InChIKey | ATSUCJLIUNAALW-UHFFFAOYSA-N |
| SMILES | CC1C2(CNC2)CN1S(=O)C(C)(C)C |
Computed by PubChem (NCBI)