Products 2847131-53-5
CAS 2847131-53-5 is the registry number for Aβ Fibrillization modulator 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 4-[[5-(2,1,3-benzoselenadiazol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]benzoate (CAS 2847131-53-5) is a chemical compound with the molecular formula C17H12N4O3SSe and a molecular weight of 431.3 g/mol. IUPAC name: methyl 4-[[5-(2,1,3-benzoselenadiazol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]benzoate. InChIKey: QBQUSTMQMBODRN-UHFFFAOYSA-N.
| Molecular formula | C17H12N4O3SSe |
|---|---|
| Molecular weight | 431.3 g/mol |
| IUPAC name | methyl 4-[[5-(2,1,3-benzoselenadiazol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]benzoate |
| InChIKey | QBQUSTMQMBODRN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)CSC2=NN=C(O2)C3=CC4=N[Se]N=C4C=C3 |
Computed by PubChem (NCBI)
Synonyms:
A|A Fibrillization modulator 1