CAS 28480-27-5 is the registry number for 2,3-Bis(4-(1,1-dimethylethyl)phenyl)-2-cyclopropen-1-one. Offered by: TRC. Available pack sizes: 250mg.
2,3-bis(4-tert-butylphenyl)cycloprop-2-en-1-one (CAS 28480-27-5) is a chemical compound with the molecular formula C23H26O and a molecular weight of 318.5 g/mol. IUPAC name: 2,3-bis(4-tert-butylphenyl)cycloprop-2-en-1-one. InChIKey: HNAISDRWPIORDV-UHFFFAOYSA-N.
| Molecular formula | C23H26O |
|---|---|
| Molecular weight | 318.5 g/mol |
| IUPAC name | 2,3-bis(4-tert-butylphenyl)cycloprop-2-en-1-one |
| InChIKey | HNAISDRWPIORDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=C(C2=O)C3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)