CAS 2850326-76-8 is the registry number for (S)-1-((S)-4,4-Difluoro-1-methylpyrrolidin-2-yl)ethan-1-ol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanol (CAS 2850326-76-8) is a chemical compound with the molecular formula C7H13F2NO and a molecular weight of 165.18 g/mol. IUPAC name: (1S)-1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanol. InChIKey: BFILDPXZQTYUDZ-WDSKDSINSA-N.
| Molecular formula | C7H13F2NO |
|---|---|
| Molecular weight | 165.18 g/mol |
| IUPAC name | (1S)-1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanol |
| InChIKey | BFILDPXZQTYUDZ-WDSKDSINSA-N |
| SMILES | C[C@@H]([C@@H]1CC(CN1C)(F)F)O |
Computed by PubChem (NCBI)