CAS 2850365-91-0 is the registry number for Methyl (1S,3S,4S)-5-hydroxy-2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Methyl (1S,3S,4S)-5-hydroxy-2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane-3-carboxylate (CAS 2850365-91-0) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 275.34 g/mol. IUPAC name: methyl (1S,3S,4S)-5-hydroxy-2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane-3-carboxylate. InChIKey: HAFKDLVYWULEIR-VYXUXIKCSA-N.
| Molecular formula | C16H21NO3 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | methyl (1S,3S,4S)-5-hydroxy-2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane-3-carboxylate |
| InChIKey | HAFKDLVYWULEIR-VYXUXIKCSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)N2[C@H]3C[C@@H]([C@H]2C(=O)OC)C(C3)O |
Computed by PubChem (NCBI)