Products 1267266-94-3

CAS 1267266-94-3 is the registry number for 3-[1-(4-Methylbenzoyl)piperidin-4-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[1-(4-methylbenzoyl)piperidin-4-yl]propanoic acid (CAS 1267266-94-3) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 275.34 g/mol. IUPAC name: 3-[1-(4-methylbenzoyl)piperidin-4-yl]propanoic acid. InChIKey: WQMRGGUAJQZGIX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H21NO3
Molecular weight275.34 g/mol
IUPAC name3-[1-(4-methylbenzoyl)piperidin-4-yl]propanoic acid
InChIKeyWQMRGGUAJQZGIX-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C(=O)N2CCC(CC2)CCC(=O)O

Computed by PubChem (NCBI)