Products 285132-89-0
CAS 285132-89-0 appears in our catalog under these names: 2,6-Diethylaniline-d15, 97 atom % D, min 98% Chemical Purity, 2,6-Diethylaniline-d15. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
N,N,3,4,5-pentadeuterio-2,6-bis(1,1,2,2,2-pentadeuterioethyl)aniline (CAS 285132-89-0) is a chemical compound with the molecular formula C10H15N and a molecular weight of 164.32 g/mol. IUPAC name: N,N,3,4,5-pentadeuterio-2,6-bis(1,1,2,2,2-pentadeuterioethyl)aniline. InChIKey: FOYHNROGBXVLLX-IFODOZFGSA-N.
| Molecular formula | C10H15N |
|---|---|
| Molecular weight | 164.32 g/mol |
| IUPAC name | N,N,3,4,5-pentadeuterio-2,6-bis(1,1,2,2,2-pentadeuterioethyl)aniline |
| InChIKey | FOYHNROGBXVLLX-IFODOZFGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])C([2H])([2H])[2H])N([2H])[2H])C([2H])([2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)