CAS 285138-81-0 appears in our catalog under these names: Chlorpyrifos-d10, Chlorpyrifos (Diethyl-d10), >95% (HPLC), Chlorpyrifos D10 (diethyl D10), Chlorpyrifos D10 (diethyl D10) 100 µg/mL in Acetone, Chlorpyrifos D10 (diethyl D10) 1000 µg/mL in Acetone. Offered by: Chemat Brand, Hubei YoungXin, TRC, Dr. Ehrenstorfer, CDN. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
Bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-[(3,5,6-trichloro-2-pyridinyl)oxy]-lambda5-phosphane (CAS 285138-81-0) is a chemical compound with the molecular formula C9H11Cl3NO3PS and a molecular weight of 360.6 g/mol. IUPAC name: bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-[(3,5,6-trichloro-2-pyridinyl)oxy]-lambda5-phosphane. InChIKey: SBPBAQFWLVIOKP-MWUKXHIBSA-N.
| Molecular formula | C9H11Cl3NO3PS |
|---|---|
| Molecular weight | 360.6 g/mol |
| IUPAC name | bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-[(3,5,6-trichloro-2-pyridinyl)oxy]-lambda5-phosphane |
| InChIKey | SBPBAQFWLVIOKP-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OP(=S)(OC1=NC(=C(C=C1Cl)Cl)Cl)OC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)