CAS 2851463-63-1 is the registry number for Fmoc-L-His(2-Thio)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 100mg, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)propanoic acid (CAS 2851463-63-1) is a chemical compound with the molecular formula C21H19N3O4S and a molecular weight of 409.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)propanoic acid. InChIKey: PXNMEZBFFSNXDR-SFHVURJKSA-N.
| Molecular formula | C21H19N3O4S |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)propanoic acid |
| InChIKey | PXNMEZBFFSNXDR-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC(=S)N4)C(=O)O |
Computed by PubChem (NCBI)