CAS 2851485-13-5 is the registry number for 3-(7-Chloro-6-(hydroxymethyl)-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[4-chloro-5-(hydroxymethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2851485-13-5) is a chemical compound with the molecular formula C14H13ClN2O4 and a molecular weight of 308.71 g/mol. IUPAC name: 3-[4-chloro-5-(hydroxymethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: UZDNBVVYUTUIMU-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O4 |
|---|---|
| Molecular weight | 308.71 g/mol |
| IUPAC name | 3-[4-chloro-5-(hydroxymethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | UZDNBVVYUTUIMU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C(=C(C=C3)CO)Cl |
Computed by PubChem (NCBI)