CAS 2851993-73-0 is the registry number for RJG-2036. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(2-methoxyphenyl)piperazin-1-yl]-[3-(1,2,4-triazol-1-ylsulfonyl)phenyl]methanone (CAS 2851993-73-0) is a chemical compound with the molecular formula C20H21N5O4S and a molecular weight of 427.5 g/mol. IUPAC name: [4-(2-methoxyphenyl)piperazin-1-yl]-[3-(1,2,4-triazol-1-ylsulfonyl)phenyl]methanone. InChIKey: HVBZFMRGJNOKLI-UHFFFAOYSA-N.
| Molecular formula | C20H21N5O4S |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | [4-(2-methoxyphenyl)piperazin-1-yl]-[3-(1,2,4-triazol-1-ylsulfonyl)phenyl]methanone |
| InChIKey | HVBZFMRGJNOKLI-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2CCN(CC2)C(=O)C3=CC(=CC=C3)S(=O)(=O)N4C=NC=N4 |
Computed by PubChem (NCBI)