Products 2852-69-9

CAS 2852-69-9 is the registry number for Lenvatinib Impurity 109. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2,6-dibromo-4-iminocyclohexa-2,5-dien-1-one (CAS 2852-69-9) is a chemical compound with the molecular formula C6H3Br2NO and a molecular weight of 264.90 g/mol. IUPAC name: 2,6-dibromo-4-iminocyclohexa-2,5-dien-1-one. InChIKey: VTYCYFFHLFIUNW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Br2NO
Molecular weight264.90 g/mol
IUPAC name2,6-dibromo-4-iminocyclohexa-2,5-dien-1-one
InChIKeyVTYCYFFHLFIUNW-UHFFFAOYSA-N
SMILESC1=C(C(=O)C(=CC1=N)Br)Br

Computed by PubChem (NCBI)