CAS 2852760-66-6 is the registry number for Rel-tert-butyl (1R,5S,8r)-8-iodo-3-azabicyclo[3.2.1]octane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R,5S)-8-iodo-3-azabicyclo[3.2.1]octane-3-carboxylate (CAS 2852760-66-6) is a chemical compound with the molecular formula C12H20INO2 and a molecular weight of 337.20 g/mol. IUPAC name: tert-butyl (1R,5S)-8-iodo-3-azabicyclo[3.2.1]octane-3-carboxylate. InChIKey: HKYBJZVTHVOXKC-ULKQDVFKSA-N.
| Molecular formula | C12H20INO2 |
|---|---|
| Molecular weight | 337.20 g/mol |
| IUPAC name | tert-butyl (1R,5S)-8-iodo-3-azabicyclo[3.2.1]octane-3-carboxylate |
| InChIKey | HKYBJZVTHVOXKC-ULKQDVFKSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC[C@@H](C1)C2I |
Computed by PubChem (NCBI)