Products 2852766-00-6
CAS 2852766-00-6 is the registry number for tert-butyl (1R,5S)-1-(methoxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl (1R,5S)-1-(methoxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 2852766-00-6) is a chemical compound with the molecular formula C13H24N2O3 and a molecular weight of 256.34 g/mol. IUPAC name: tert-butyl (1R,5S)-1-(methoxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: QUSBMMYGLKLMND-GXFFZTMASA-N.
| Molecular formula | C13H24N2O3 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | tert-butyl (1R,5S)-1-(methoxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | QUSBMMYGLKLMND-GXFFZTMASA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CC[C@@]1(CNC2)COC |
Computed by PubChem (NCBI)