CAS 2852767-30-5 is the registry number for 4-Bromo-1,5-dichloro-2-(methoxymethoxy)naphthalene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-1,5-dichloro-2-(methoxymethoxy)naphthalene (CAS 2852767-30-5) is a chemical compound with the molecular formula C12H9BrCl2O2 and a molecular weight of 336.00 g/mol. IUPAC name: 4-bromo-1,5-dichloro-2-(methoxymethoxy)naphthalene. InChIKey: ZBDAUSATXATOJD-UHFFFAOYSA-N.
| Molecular formula | C12H9BrCl2O2 |
|---|---|
| Molecular weight | 336.00 g/mol |
| IUPAC name | 4-bromo-1,5-dichloro-2-(methoxymethoxy)naphthalene |
| InChIKey | ZBDAUSATXATOJD-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=C2C(=C1Cl)C=CC=C2Cl)Br |
Computed by PubChem (NCBI)