CAS 2852779-63-4 is the registry number for 4,4'-(Pyrene-2,7-diyl)dibenzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[7-(4-formylphenyl)pyren-2-yl]benzaldehyde (CAS 2852779-63-4) is a chemical compound with the molecular formula C30H18O2 and a molecular weight of 410.5 g/mol. IUPAC name: 4-[7-(4-formylphenyl)pyren-2-yl]benzaldehyde. InChIKey: HCWZSWFDESRZSO-UHFFFAOYSA-N.
| Molecular formula | C30H18O2 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 4-[7-(4-formylphenyl)pyren-2-yl]benzaldehyde |
| InChIKey | HCWZSWFDESRZSO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC3=C4C(=C2)C=CC5=CC(=CC(=C54)C=C3)C6=CC=C(C=C6)C=O |
Computed by PubChem (NCBI)