CAS 2243312-96-9 appears in our catalog under these names: 4,4'–(Pyrene–1,6–diyl)dibenzaldehyde, 4,4'-(Pyrene-1,6-diyl)dibenzaldehyde, 97%, 97%, 4,4'-(Pyrene-1,6-diyl)dibenzaldehyde, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
4-[6-(4-formylphenyl)pyren-1-yl]benzaldehyde (CAS 2243312-96-9) is a chemical compound with the molecular formula C30H18O2 and a molecular weight of 410.5 g/mol. IUPAC name: 4-[6-(4-formylphenyl)pyren-1-yl]benzaldehyde. InChIKey: BRCRRFATSAHBCW-UHFFFAOYSA-N.
| Molecular formula | C30H18O2 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 4-[6-(4-formylphenyl)pyren-1-yl]benzaldehyde |
| InChIKey | BRCRRFATSAHBCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC3=C4C2=C1C=CC4=C(C=C3)C5=CC=C(C=C5)C=O)C6=CC=C(C=C6)C=O |
Computed by PubChem (NCBI)