CAS 2854339-29-8 is the registry number for Potassium (S)-trifluoro((3-methylpiperidin-1-yl)methyl)borate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium trifluoro-[[(3S)-3-methylpiperidin-1-yl]methyl]boranuide (CAS 2854339-29-8) is a chemical compound with the molecular formula C7H14BF3KN and a molecular weight of 219.10 g/mol. IUPAC name: potassium trifluoro-[[(3S)-3-methylpiperidin-1-yl]methyl]boranuide. InChIKey: IVGVUNPPGPWALH-FJXQXJEOSA-N.
| Molecular formula | C7H14BF3KN |
|---|---|
| Molecular weight | 219.10 g/mol |
| IUPAC name | potassium trifluoro-[[(3S)-3-methylpiperidin-1-yl]methyl]boranuide |
| InChIKey | IVGVUNPPGPWALH-FJXQXJEOSA-N |
| SMILES | [B-](CN1CCC[C@@H](C1)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)