Products 2856019-34-4
CAS 2856019-34-4 is the registry number for ((1AR,6aR)-4-methylenehexahydrocyclopropa[b]pyrrolizin-5a(3H)-yl)methanol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,4R)-8-methylidene-1-azatricyclo[4.3.0.02,4]nonan-6-yl]methanol (CAS 2856019-34-4) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 165.23 g/mol. IUPAC name: [(2R,4R)-8-methylidene-1-azatricyclo[4.3.0.02,4]nonan-6-yl]methanol. InChIKey: AZAABDHYVXCMSN-MGRQHWMJSA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 165.23 g/mol |
| IUPAC name | [(2R,4R)-8-methylidene-1-azatricyclo[4.3.0.02,4]nonan-6-yl]methanol |
| InChIKey | AZAABDHYVXCMSN-MGRQHWMJSA-N |
| SMILES | C=C1CC2(C[C@H]3C[C@H]3N2C1)CO |
Computed by PubChem (NCBI)