Products 2856379-97-8
CAS 2856379-97-8 is the registry number for Antifungal agent 74. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(trichloromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (CAS 2856379-97-8) is a chemical compound with the molecular formula C4HCl3N4S and a molecular weight of 243.5 g/mol. IUPAC name: 6-(trichloromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole. InChIKey: DRGFPDFHBVFUCA-UHFFFAOYSA-N.
| Molecular formula | C4HCl3N4S |
|---|---|
| Molecular weight | 243.5 g/mol |
| IUPAC name | 6-(trichloromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| InChIKey | DRGFPDFHBVFUCA-UHFFFAOYSA-N |
| SMILES | C1=NN=C2N1N=C(S2)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 74, orb1944173