Products 2857037-76-2
CAS 2857037-76-2 is the registry number for tert-Butyl (3-(benzo[d][1,3]dioxole-5-carbonyl)bicyclo[1.1.1]pentan-1-yl)carbamate 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Tert-butyl N-[3-(1,3-benzodioxole-5-carbonyl)-1-bicyclo[1.1.1]pentanyl]carbamate (CAS 2857037-76-2) is a chemical compound with the molecular formula C18H21NO5 and a molecular weight of 331.4 g/mol. IUPAC name: tert-butyl N-[3-(1,3-benzodioxole-5-carbonyl)-1-bicyclo[1.1.1]pentanyl]carbamate. InChIKey: CLAYDBCTAJUQMJ-UHFFFAOYSA-N.
| Molecular formula | C18H21NO5 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | tert-butyl N-[3-(1,3-benzodioxole-5-carbonyl)-1-bicyclo[1.1.1]pentanyl]carbamate |
| InChIKey | CLAYDBCTAJUQMJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CC(C1)(C2)C(=O)C3=CC4=C(C=C3)OCO4 |
Computed by PubChem (NCBI)