CAS 73257-47-3 is the registry number for Dimethyl 4-(4-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 10g, 25g.
Dimethyl 4-(4-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 73257-47-3) is a chemical compound with the molecular formula C18H21NO5 and a molecular weight of 331.4 g/mol. IUPAC name: dimethyl 4-(4-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: IAXDEFZXLVTHLU-UHFFFAOYSA-N.
| Molecular formula | C18H21NO5 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | dimethyl 4-(4-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | IAXDEFZXLVTHLU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC)C2=CC=C(C=C2)OC)C(=O)OC |
Computed by PubChem (NCBI)