CAS 2857093-16-2 is the registry number for 6-Chloro-5,7-difluoro-3,4-dihydroisoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-5,7-difluoro-3,4-dihydro-2H-isoquinolin-1-one (CAS 2857093-16-2) is a chemical compound with the molecular formula C9H6ClF2NO and a molecular weight of 217.60 g/mol. IUPAC name: 6-chloro-5,7-difluoro-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: DJIHXTUJPSPTLA-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF2NO |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | 6-chloro-5,7-difluoro-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | DJIHXTUJPSPTLA-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=CC(=C(C(=C21)F)Cl)F |
Computed by PubChem (NCBI)