CAS 2857815-89-3 is the registry number for 6-Bromo-4,4-difluoro-3-methoxy-3-methyl-3,4-dihydroisoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4,4-difluoro-3-methoxy-3-methyl-2H-isoquinolin-1-one (CAS 2857815-89-3) is a chemical compound with the molecular formula C11H10BrF2NO2 and a molecular weight of 306.10 g/mol. IUPAC name: 6-bromo-4,4-difluoro-3-methoxy-3-methyl-2H-isoquinolin-1-one. InChIKey: SNTHXGJLWJIELA-UHFFFAOYSA-N.
| Molecular formula | C11H10BrF2NO2 |
|---|---|
| Molecular weight | 306.10 g/mol |
| IUPAC name | 6-bromo-4,4-difluoro-3-methoxy-3-methyl-2H-isoquinolin-1-one |
| InChIKey | SNTHXGJLWJIELA-UHFFFAOYSA-N |
| SMILES | CC1(C(C2=C(C=CC(=C2)Br)C(=O)N1)(F)F)OC |
Computed by PubChem (NCBI)