Products 2857910-03-1
CAS 2857910-03-1 is the registry number for 2-Methoxy-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
2-methoxy-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2857910-03-1) is a chemical compound with the molecular formula C13H20BNO3 and a molecular weight of 249.12 g/mol. IUPAC name: 2-methoxy-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: YPDYOTOWHXURCL-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO3 |
|---|---|
| Molecular weight | 249.12 g/mol |
| IUPAC name | 2-methoxy-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | YPDYOTOWHXURCL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)OC)C |
Computed by PubChem (NCBI)