Products 285977-82-4
CAS 285977-82-4 appears in our catalog under these names: 4-Fluorobenzoic acid-13C,d4, 4-FLUOROBENZOIC-CARBOXY-13C-2,3,5,6-D4 &. Offered by: MedChemExpress, Sigma-Aldrich. Available pack sizes: Get quote, 100MG.
2,3,5,6-tetradeuterio-4-fluoro(13C)benzoic acid (CAS 285977-82-4) is a chemical compound with the molecular formula C7H5FO2 and a molecular weight of 145.13 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-fluoro(13C)benzoic acid. InChIKey: BBYDXOIZLAWGSL-YRTBNJHASA-N.
| Molecular formula | C7H5FO2 |
|---|---|
| Molecular weight | 145.13 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-fluoro(13C)benzoic acid |
| InChIKey | BBYDXOIZLAWGSL-YRTBNJHASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[13C](=O)O)[2H])[2H])F)[2H] |
Computed by PubChem (NCBI)