CAS 28599-75-9 appears in our catalog under these names: 4-(3-Chloroadamantan-1-yl)thiazol-2-amine, 97%, 4-(3-Chloro-adamantan-1-yl)-thiazol-2-ylamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 50mg, 0,5g.
4-(3-chloro-1-adamantyl)-1,3-thiazol-2-amine (CAS 28599-75-9) is a chemical compound with the molecular formula C13H17ClN2S and a molecular weight of 268.81 g/mol. IUPAC name: 4-(3-chloro-1-adamantyl)-1,3-thiazol-2-amine. InChIKey: TXTLCPGTCAUVNV-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2S |
|---|---|
| Molecular weight | 268.81 g/mol |
| IUPAC name | 4-(3-chloro-1-adamantyl)-1,3-thiazol-2-amine |
| InChIKey | TXTLCPGTCAUVNV-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)Cl)C4=CSC(=N4)N |
Computed by PubChem (NCBI)