Products 286013-00-1
CAS 286013-00-1 appears in our catalog under these names: Trimethylamine-13C3 Hydrochloride, 98% +98%atom%13C, Trimethylamine-13C3 Hydrochloride, >95% (HPLC), Trimethylamine-¹³C3 Hydrochloride, ≥95 atom% 13C,≥97%, ≥95 atom% 13C,≥97%, Trimethylammonium chloride-13C3. Offered by: Chemat Brand, TRC, Chemat, MedChemExpress. Available pack sizes: on request, 250mg, 25mg, 500mg, 1mg, 5 mg, 1 mg.
N,N-di((113C)methyl)(113C)methanamine;hydrochloride (CAS 286013-00-1) is a chemical compound with the molecular formula C3H10ClN and a molecular weight of 98.55 g/mol. IUPAC name: N,N-di((113C)methyl)(113C)methanamine;hydrochloride. InChIKey: SZYJELPVAFJOGJ-HCULJTSZSA-N.
| Molecular formula | C3H10ClN |
|---|---|
| Molecular weight | 98.55 g/mol |
| IUPAC name | N,N-di((113C)methyl)(113C)methanamine;hydrochloride |
| InChIKey | SZYJELPVAFJOGJ-HCULJTSZSA-N |
| SMILES | [13CH3]N([13CH3])[13CH3].Cl |
Computed by PubChem (NCBI)
Synonyms:
Trimethylamine-13C3 Hydrochloride, Trimethylamine-(1)(3)C3 Hydrochloride, N,N-Di((113C)methyl)(113C)methanamine;hydrochloride, Trimethylammonium chloride-13C3, N,N-Di(methyl-13C2)methanamine-13C Hydrochloride, Trimethyl-13C3-amine hydrochloride, 99 atom % 13C, N,N-Bis[(~13~C)methyl](~13~C)methanamine--hydrogen chloride (1/1)