CAS 286013-07-8 is the registry number for CYANURIC-13C3 CHLORIDE, 99 ATOM % 13C. Offered by: Sigma-Aldrich. Available pack sizes: 100MG.
2,4,6-trichloro-(2,4,6-13C3)1,3,5-triazine (CAS 286013-07-8) is a chemical compound with the molecular formula C3Cl3N3 and a molecular weight of 187.39 g/mol. IUPAC name: 2,4,6-trichloro-(2,4,6-13C3)1,3,5-triazine. InChIKey: MGNCLNQXLYJVJD-VMIGTVKRSA-N.
| Molecular formula | C3Cl3N3 |
|---|---|
| Molecular weight | 187.39 g/mol |
| IUPAC name | 2,4,6-trichloro-(2,4,6-13C3)1,3,5-triazine |
| InChIKey | MGNCLNQXLYJVJD-VMIGTVKRSA-N |
| SMILES | [13C]1(=N[13C](=N[13C](=N1)Cl)Cl)Cl |
Computed by PubChem (NCBI)