Products 2860566-81-8
CAS 2860566-81-8 is the registry number for (R)-5-(tert-Butyl)-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-2-ium tetrafluoroborate, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[(3S,5R)-5-methylpiperidin-3-yl]methanol;hydrochloride (CAS 2860566-81-8) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: [(3S,5R)-5-methylpiperidin-3-yl]methanol;hydrochloride. InChIKey: HJFJEUUOCJWTIB-HHQFNNIRSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | [(3S,5R)-5-methylpiperidin-3-yl]methanol;hydrochloride |
| InChIKey | HJFJEUUOCJWTIB-HHQFNNIRSA-N |
| SMILES | C[C@@H]1C[C@@H](CNC1)CO.Cl |
Computed by PubChem (NCBI)