Products 2861495-93-2
CAS 2861495-93-2 is the registry number for 1,1-DIMETHYLETHYL 3-(3,5-DIMETHYLBENZOYL)-3,8-DIAZABICYCLO[3.2.1]OCTANE-8-CARBOXYLATE, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(3,5-dimethylbenzoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 2861495-93-2) is a chemical compound with the molecular formula C20H28N2O3 and a molecular weight of 344.4 g/mol. IUPAC name: tert-butyl 3-(3,5-dimethylbenzoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: WBLRDOUCSQYKMG-UHFFFAOYSA-N.
| Molecular formula | C20H28N2O3 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | tert-butyl 3-(3,5-dimethylbenzoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | WBLRDOUCSQYKMG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)N2CC3CCC(C2)N3C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)