CAS 1630086-22-4 appears in our catalog under these names: tert-Butyl (6-((diethylamino)methyl)-5-hydroxynaphthalen-1-yl)carbamate, 95%, tert-Butyl (6-((diethylamino)methyl)-5-hydroxynaphthalen-1-yl)carbamate 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
Tert-butyl N-[6-(diethylaminomethyl)-5-hydroxynaphthalen-1-yl]carbamate (CAS 1630086-22-4) is a chemical compound with the molecular formula C20H28N2O3 and a molecular weight of 344.4 g/mol. IUPAC name: tert-butyl N-[6-(diethylaminomethyl)-5-hydroxynaphthalen-1-yl]carbamate. InChIKey: HUJVIXVNRMGGAJ-UHFFFAOYSA-N.
| Molecular formula | C20H28N2O3 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | tert-butyl N-[6-(diethylaminomethyl)-5-hydroxynaphthalen-1-yl]carbamate |
| InChIKey | HUJVIXVNRMGGAJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC1=C(C2=C(C=C1)C(=CC=C2)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)