Products 28619-41-2
CAS 28619-41-2 appears in our catalog under these names: Erythristemine, (+)-Erythristemine, ≥90%. Offered by: Biosynth, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
(2R,9R,13bS)-2,9,11,12-tetramethoxy-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinoline (CAS 28619-41-2) is a chemical compound with the molecular formula C20H25NO4 and a molecular weight of 343.4 g/mol. IUPAC name: (2R,9R,13bS)-2,9,11,12-tetramethoxy-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinoline. InChIKey: IUMRZRWBQPPMSS-GKCIPKSASA-N.
| Molecular formula | C20H25NO4 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | (2R,9R,13bS)-2,9,11,12-tetramethoxy-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinoline |
| InChIKey | IUMRZRWBQPPMSS-GKCIPKSASA-N |
| SMILES | CO[C@@H]1C[C@@]23C(=CCN2C[C@@H](C4=CC(=C(C=C34)OC)OC)OC)C=C1 |
Computed by PubChem (NCBI)