Products 2862784-20-9
CAS 2862784-20-9 appears in our catalog under these names: CIDD–0149897, CIDD-0149897, 99.91%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10 mg, 5 mg, 25 mg, 50 mg, 100 mg.
(2E)-6-(3-fluoro-4-hydroxyphenyl)-2-hydroxyimino-3H-inden-1-one (CAS 2862784-20-9) is a chemical compound with the molecular formula C15H10FNO3 and a molecular weight of 271.24 g/mol. IUPAC name: (2E)-6-(3-fluoro-4-hydroxyphenyl)-2-hydroxyimino-3H-inden-1-one. InChIKey: XIWQAWUOXXYWMB-GHRIWEEISA-N.
| Molecular formula | C15H10FNO3 |
|---|---|
| Molecular weight | 271.24 g/mol |
| IUPAC name | (2E)-6-(3-fluoro-4-hydroxyphenyl)-2-hydroxyimino-3H-inden-1-one |
| InChIKey | XIWQAWUOXXYWMB-GHRIWEEISA-N |
| SMILES | C\1C2=C(C=C(C=C2)C3=CC(=C(C=C3)O)F)C(=O)/C1=N/O |
Computed by PubChem (NCBI)