CAS 524684-52-4 appears in our catalog under these names: Prinaberel, 95%, ERB 041, Prinaberel, Prinaberel 98+%, 2-(3-Fluoro-4-hydroxyphenyl)-7-vinylbenzo[d]oxazol-5-ol, 98+%, 98+%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 250mg, 10mg, 50mg, 2mg, 1mg, 5mg, 100mg, 1g.
7-ethenyl-2-(3-fluoro-4-hydroxyphenyl)-1,3-benzoxazol-5-ol (CAS 524684-52-4) is a chemical compound with the molecular formula C15H10FNO3 and a molecular weight of 271.24 g/mol. IUPAC name: 7-ethenyl-2-(3-fluoro-4-hydroxyphenyl)-1,3-benzoxazol-5-ol. InChIKey: MQIMZDXIAHJKQP-UHFFFAOYSA-N.
| Molecular formula | C15H10FNO3 |
|---|---|
| Molecular weight | 271.24 g/mol |
| IUPAC name | 7-ethenyl-2-(3-fluoro-4-hydroxyphenyl)-1,3-benzoxazol-5-ol |
| InChIKey | MQIMZDXIAHJKQP-UHFFFAOYSA-N |
| SMILES | C=CC1=C2C(=CC(=C1)O)N=C(O2)C3=CC(=C(C=C3)O)F |
Computed by PubChem (NCBI)