Products 2862800-15-3
CAS 2862800-15-3 is the registry number for Colistin adjuvant-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-5-(trifluoromethyl)phenol (CAS 2862800-15-3) is a chemical compound with the molecular formula C16H7F9N2O and a molecular weight of 414.22 g/mol. IUPAC name: 2-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-5-(trifluoromethyl)phenol. InChIKey: FEWKIBJEQKCCIW-UHFFFAOYSA-N.
| Molecular formula | C16H7F9N2O |
|---|---|
| Molecular weight | 414.22 g/mol |
| IUPAC name | 2-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-5-(trifluoromethyl)phenol |
| InChIKey | FEWKIBJEQKCCIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)O)C2=NC3=C(C=C(C=C3N2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Colistin adjuvant-1