CAS 2862825-40-7 is the registry number for 4-Chloro-5-fluoro-3,3-dimethyl-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-5-fluoro-3,3-dimethyl-1H-pyrrolo[2,3-b]pyridin-2-one (CAS 2862825-40-7) is a chemical compound with the molecular formula C9H8ClFN2O and a molecular weight of 214.62 g/mol. IUPAC name: 4-chloro-5-fluoro-3,3-dimethyl-1H-pyrrolo[2,3-b]pyridin-2-one. InChIKey: PHHCYQLRBDVQEK-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFN2O |
|---|---|
| Molecular weight | 214.62 g/mol |
| IUPAC name | 4-chloro-5-fluoro-3,3-dimethyl-1H-pyrrolo[2,3-b]pyridin-2-one |
| InChIKey | PHHCYQLRBDVQEK-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=CN=C2NC1=O)F)Cl)C |
Computed by PubChem (NCBI)