Products 2863-04-9
CAS 2863-04-9 appears in our catalog under these names: Thymidine 3',5'-disphosphate, Thymidine-3',5'-diphosphate sodium salt, 500 µg, Thymidine-3',5'-diphosphate sodium salt, 1 mg, Thymidine-3',5'-diphosphate sodium salt, 2 mg, Thymidine-3',5'-diphosphate sodium salt, 5 mg. Offered by: MedChemExpress, Roth. Available pack sizes: 5mg, 1mg, 500µg, 2mg, 10mg.
[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate (CAS 2863-04-9) is a chemical compound with the molecular formula C10H16N2O11P2 and a molecular weight of 402.19 g/mol. IUPAC name: [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate. InChIKey: CSNCBOPUCJOHLS-XLPZGREQSA-N.
| Molecular formula | C10H16N2O11P2 |
|---|---|
| Molecular weight | 402.19 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
| InChIKey | CSNCBOPUCJOHLS-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)COP(=O)(O)O)OP(=O)(O)O |
Computed by PubChem (NCBI)